C13H19FO3 — CID 117357814
2-[5-(1-fluoroethyl)-2,4-dimethoxyphenyl]propan-2-ol (PubChem CID 117357814) has the molecular formula C13H19FO3 and a molecular weight of 242.29 g/mol. Its IUPAC name is 2-[5-(1-fluoroethyl)-2,4-dimethoxyphenyl]propan-2-ol.
| Compound Name | 2-[5-(1-fluoroethyl)-2,4-dimethoxyphenyl]propan-2-ol |
|---|---|
| PubChem CID | 117357814 |
| Molecular Formula | C13H19FO3 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-[5-(1-fluoroethyl)-2,4-dimethoxyphenyl]propan-2-ol |
| SMILES | COc1cc(OC)c(C(C)(C)O)cc1C(C)F |
| InChI | InChI=1S/C13H19FO3/c1-8(14)9-6-10(13(2,3)15)12(17-5)7-11(9)16-4/h6-8,15H,1-5H3 |
| InChIKey | BCZLJYSUEKJSIV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |