C14H24O3 — CID 145081658
2-(2,5-dimethoxy-4-methylphenyl)propan-2-ol;ethane (PubChem CID 145081658) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-4-methylphenyl)propan-2-ol;ethane.
| Compound Name | 2-(2,5-dimethoxy-4-methylphenyl)propan-2-ol;ethane |
|---|---|
| PubChem CID | 145081658 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2-(2,5-dimethoxy-4-methylphenyl)propan-2-ol;ethane |
| SMILES | CC.COc1cc(C(C)(C)O)c(OC)cc1C |
| InChI | InChI=1S/C12H18O3.C2H6/c1-8-6-11(15-5)9(12(2,3)13)7-10(8)14-4;1-2/h6-7,13H,1-5H3;1-2H3 |
| InChIKey | UDLFPIRIDZLHAD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |