C35H58O2P+ — CID 129084965
tritert-butyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphanium (PubChem CID 129084965) has the molecular formula C35H58O2P+ and a molecular weight of 541.82 g/mol. Its IUPAC name is tritert-butyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphanium.
| Compound Name | tritert-butyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphanium |
|---|---|
| PubChem CID | 129084965 |
| Molecular Formula | C35H58O2P+ |
| Molecular Weight | 541.82 g/mol |
| Exact Mass | 541.42 |
| IUPAC Name | tritert-butyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphanium |
| SMILES | COc1ccc(OC)c([P+](C(C)(C)C)(C(C)(C)C)C(C)(C)C)c1-c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C35H58O2P/c1-22(2)25-20-26(23(3)4)30(27(21-25)24(5)6)31-28(36-16)18-19-29(37-17)32(31)38(33(7,8)9,34(10,11)12)35(13,14)15/h18-24H,1-17H3/q+1 |
| InChIKey | AIWAFEXFUPTRRL-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.82 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|