C32H52O4PS+ — CID 175089498
ditert-butyl-[6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-methylsulfonyloxyphosphanium (PubChem CID 175089498) has the molecular formula C32H52O4PS+ and a molecular weight of 563.81 g/mol. Its IUPAC name is ditert-butyl-[6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-methylsulfonyloxyphosphanium.
| Compound Name | ditert-butyl-[6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-methylsulfonyloxyphosphanium |
|---|---|
| PubChem CID | 175089498 |
| Molecular Formula | C32H52O4PS+ |
| Molecular Weight | 563.81 g/mol |
| Exact Mass | 563.33 |
| IUPAC Name | ditert-butyl-[6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-methylsulfonyloxyphosphanium |
| SMILES | COc1ccc(C)c(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)c1[P+](OS(C)(=O)=O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C32H52O4PS/c1-20(2)24-18-25(21(3)4)29(26(19-24)22(5)6)28-23(7)16-17-27(35-14)30(28)37(31(8,9)10,32(11,12)13)36-38(15,33)34/h16-22H,1-15H3/q+1 |
| InChIKey | ILDFLWDPWYFKIB-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.81 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|