C40H61OP — CID 162418915
dicyclohexyl-[6-cyclohexyloxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane (PubChem CID 162418915) has the molecular formula C40H61OP and a molecular weight of 588.90 g/mol. Its IUPAC name is dicyclohexyl-[6-cyclohexyloxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane.
| Compound Name | dicyclohexyl-[6-cyclohexyloxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 162418915 |
| Molecular Formula | C40H61OP |
| Molecular Weight | 588.90 g/mol |
| Exact Mass | 588.45 |
| IUPAC Name | dicyclohexyl-[6-cyclohexyloxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| SMILES | Cc1ccc(OC2CCCCC2)c(P(C2CCCCC2)C2CCCCC2)c1-c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C40H61OP/c1-27(2)31-25-35(28(3)4)39(36(26-31)29(5)6)38-30(7)23-24-37(41-32-17-11-8-12-18-32)40(38)42(33-19-13-9-14-20-33)34-21-15-10-16-22-34/h23-29,32-34H,8-22H2,1-7H3 |
| InChIKey | DAFDGAGYELBYNE-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.90 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|