C45H61P — CID 139466257
[2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-phenyl-propan-2-ylphosphane (PubChem CID 139466257) has the molecular formula C45H61P and a molecular weight of 632.96 g/mol. Its IUPAC name is [2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-phenyl-propan-2-ylphosphane.
| Compound Name | [2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-phenyl-propan-2-ylphosphane |
|---|---|
| PubChem CID | 139466257 |
| Molecular Formula | C45H61P |
| Molecular Weight | 632.96 g/mol |
| Exact Mass | 632.45 |
| IUPAC Name | [2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-phenyl-propan-2-ylphosphane |
| SMILES | CC(C)c1cc(C(C)C)c(-c2cccc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c2P(c2ccccc2)C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C45H61P/c1-27(2)34-23-39(29(5)6)43(40(24-34)30(7)8)37-21-18-22-38(45(37)46(33(13)14)36-19-16-15-17-20-36)44-41(31(9)10)25-35(28(3)4)26-42(44)32(11)12/h15-33H,1-14H3 |
| InChIKey | WTZCUXLKQQDXBD-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.96 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|