C28H28P2 — CID 2724948
[(2R,3R)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane (PubChem CID 2724948) has the molecular formula C28H28P2 and a molecular weight of 426.48 g/mol. Its IUPAC name is [(2R,3R)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane.
| Compound Name | [(2R,3R)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 2724948 |
| Molecular Formula | C28H28P2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [(2R,3R)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane |
| SMILES | C[C@H]([C@@H](C)P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28P2/c1-23(29(25-15-7-3-8-16-25)26-17-9-4-10-18-26)24(2)30(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-24H,1-2H3/t23-,24-/m1/s1 |
| InChIKey | FWXAUDSWDBGCMN-DNQXCXABSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|