C28H28Cl2CoP2 — CID 11364946
dichlorocobalt;[(2S,3S)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane (PubChem CID 11364946) has the molecular formula C28H28Cl2CoP2 and a molecular weight of 556.32 g/mol. Its IUPAC name is dichlorocobalt;[(2S,3S)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane.
| Compound Name | dichlorocobalt;[(2S,3S)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 11364946 |
| Molecular Formula | C28H28Cl2CoP2 |
| Molecular Weight | 556.32 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | dichlorocobalt;[(2S,3S)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane |
| SMILES | C[C@@H]([C@H](C)P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1.Cl[Co]Cl |
| InChI | InChI=1S/C28H28P2.2ClH.Co/c1-23(29(25-15-7-3-8-16-25)26-17-9-4-10-18-26)24(2)30(27-19-11-5-12-20-27)28-21-13-6-14-22-28;;;/h3-24H,1-2H3;2*1H;/q;;;+2/p-2/t23-,24-;;;/m0.../s1 |
| InChIKey | RESLVQMQXAGOQO-HFYJLKHYSA-L |
| XLogP | 7.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.32 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|