C33H38P2 — CID 22672805
[3-(1-diphenylphosphanylethyl)-3,4-dimethylpentan-2-yl]-diphenylphosphane (PubChem CID 22672805) has the molecular formula C33H38P2 and a molecular weight of 496.62 g/mol. Its IUPAC name is [3-(1-diphenylphosphanylethyl)-3,4-dimethylpentan-2-yl]-diphenylphosphane.
| Compound Name | [3-(1-diphenylphosphanylethyl)-3,4-dimethylpentan-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 22672805 |
| Molecular Formula | C33H38P2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | [3-(1-diphenylphosphanylethyl)-3,4-dimethylpentan-2-yl]-diphenylphosphane |
| SMILES | CC(C)C(C)(C(C)P(c1ccccc1)c1ccccc1)C(C)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H38P2/c1-26(2)33(5,27(3)34(29-18-10-6-11-19-29)30-20-12-7-13-21-30)28(4)35(31-22-14-8-15-23-31)32-24-16-9-17-25-32/h6-28H,1-5H3 |
| InChIKey | SKHRPWSBFZHUJT-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|