C24H23FeP-6 — CID 87995622
1-cyclopenta-2,4-dien-1-ylethyl(diphenyl)phosphane;cyclopentane;iron (PubChem CID 87995622) has the molecular formula C24H23FeP-6 and a molecular weight of 398.27 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylethyl(diphenyl)phosphane;cyclopentane;iron.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylethyl(diphenyl)phosphane;cyclopentane;iron |
|---|---|
| PubChem CID | 87995622 |
| Molecular Formula | C24H23FeP-6 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylethyl(diphenyl)phosphane;cyclopentane;iron |
| SMILES | CC([c-]1cccc1)P(c1ccccc1)c1ccccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C19H18P.C5H5.Fe/c1-16(17-10-8-9-11-17)20(18-12-4-2-5-13-18)19-14-6-3-7-15-19;1-2-4-5-3-1;/h2-16H,1H3;1-5H;/q-1;-5; |
| InChIKey | VCZOIXMFIPCPPM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|