C19H21FeP-6 — CID 174302734
cyclopenta-2,4-dien-1-yl-phenyl-propan-2-ylphosphane;cyclopentane;iron (PubChem CID 174302734) has the molecular formula C19H21FeP-6 and a molecular weight of 336.20 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-phenyl-propan-2-ylphosphane;cyclopentane;iron.
| Compound Name | cyclopenta-2,4-dien-1-yl-phenyl-propan-2-ylphosphane;cyclopentane;iron |
|---|---|
| PubChem CID | 174302734 |
| Molecular Formula | C19H21FeP-6 |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-phenyl-propan-2-ylphosphane;cyclopentane;iron |
| SMILES | CC(C)P(c1ccccc1)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C14H16P.C5H5.Fe/c1-12(2)15(14-10-6-7-11-14)13-8-4-3-5-9-13;1-2-4-5-3-1;/h3-12H,1-2H3;1-5H;/q-1;-5; |
| InChIKey | MNYCSOYSLHLEQP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|