C30H37FeNP2-6 — CID 87628773
cyclopentane;1-(3-diethylphosphanyl-2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)-N,N-dimethylethanamine;iron (PubChem CID 87628773) has the molecular formula C30H37FeNP2-6 and a molecular weight of 529.43 g/mol. Its IUPAC name is cyclopentane;1-(3-diethylphosphanyl-2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)-N,N-dimethylethanamine;iron.
| Compound Name | cyclopentane;1-(3-diethylphosphanyl-2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)-N,N-dimethylethanamine;iron |
|---|---|
| PubChem CID | 87628773 |
| Molecular Formula | C30H37FeNP2-6 |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | cyclopentane;1-(3-diethylphosphanyl-2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)-N,N-dimethylethanamine;iron |
| SMILES | CCP(CC)[c-]1ccc(C(C)N(C)C)c1P(c1ccccc1)c1ccccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C25H32NP2.C5H5.Fe/c1-6-27(7-2)24-19-18-23(20(3)26(4)5)25(24)28(21-14-10-8-11-15-21)22-16-12-9-13-17-22;1-2-4-5-3-1;/h8-20H,6-7H2,1-5H3;1-5H;/q-1;-5; |
| InChIKey | ZMYCXRGCUNTQHQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|