C24H24FeNP-6 — CID 87353736
cyclopentane;2-diphenylphosphanyl-N,N-dimethylcyclopenta-2,4-dien-1-amine;iron (PubChem CID 87353736) has the molecular formula C24H24FeNP-6 and a molecular weight of 413.28 g/mol. Its IUPAC name is cyclopentane;2-diphenylphosphanyl-N,N-dimethylcyclopenta-2,4-dien-1-amine;iron.
| Compound Name | cyclopentane;2-diphenylphosphanyl-N,N-dimethylcyclopenta-2,4-dien-1-amine;iron |
|---|---|
| PubChem CID | 87353736 |
| Molecular Formula | C24H24FeNP-6 |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | cyclopentane;2-diphenylphosphanyl-N,N-dimethylcyclopenta-2,4-dien-1-amine;iron |
| SMILES | CN(C)[c-]1cccc1P(c1ccccc1)c1ccccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C19H19NP.C5H5.Fe/c1-20(2)18-14-9-15-19(18)21(16-10-5-3-6-11-16)17-12-7-4-8-13-17;1-2-4-5-3-1;/h3-15H,1-2H3;1-5H;/q-1;-5; |
| InChIKey | HAOZMJFCICOHIV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|