C31H30FeNP-6 — CID 87708507
(1R)-N-benzyl-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethanamine;cyclopentane;iron (PubChem CID 87708507) has the molecular formula C31H30FeNP-6 and a molecular weight of 503.41 g/mol. Its IUPAC name is (1R)-N-benzyl-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethanamine;cyclopentane;iron.
| Compound Name | (1R)-N-benzyl-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethanamine;cyclopentane;iron |
|---|---|
| PubChem CID | 87708507 |
| Molecular Formula | C31H30FeNP-6 |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | (1R)-N-benzyl-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethanamine;cyclopentane;iron |
| SMILES | C[C@@H](NCc1ccccc1)[c-]1cccc1P(c1ccccc1)c1ccccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C26H25NP.C5H5.Fe/c1-21(27-20-22-12-5-2-6-13-22)25-18-11-19-26(25)28(23-14-7-3-8-15-23)24-16-9-4-10-17-24;1-2-4-5-3-1;/h2-19,21,27H,20H2,1H3;1-5H;/q-1;-5;/t21-;;/m1../s1 |
| InChIKey | SPPMROYHKCCSBC-GHVWMZMZSA-N |
| XLogP | 6.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|