C29H34FeNP-6 — CID 87708681
cyclopentane;N-[(1R)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethyl]-2,2-dimethylpropan-1-amine;iron (PubChem CID 87708681) has the molecular formula C29H34FeNP-6 and a molecular weight of 483.42 g/mol. Its IUPAC name is cyclopentane;N-[(1R)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethyl]-2,2-dimethylpropan-1-amine;iron.
| Compound Name | cyclopentane;N-[(1R)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethyl]-2,2-dimethylpropan-1-amine;iron |
|---|---|
| PubChem CID | 87708681 |
| Molecular Formula | C29H34FeNP-6 |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | cyclopentane;N-[(1R)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethyl]-2,2-dimethylpropan-1-amine;iron |
| SMILES | C[C@@H](NCC(C)(C)C)[c-]1cccc1P(c1ccccc1)c1ccccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C24H29NP.C5H5.Fe/c1-19(25-18-24(2,3)4)22-16-11-17-23(22)26(20-12-7-5-8-13-20)21-14-9-6-10-15-21;1-2-4-5-3-1;/h5-17,19,25H,18H2,1-4H3;1-5H;/q-1;-5;/t19-;;/m1../s1 |
| InChIKey | CWUYWHRPHHIHPB-JQDLGSOUSA-N |
| XLogP | 6.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|