C36H34FeN2P2 — CID 161287754
cyclopenta-1,3-dien-1-yl(diphenyl)phosphane;1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethane-1,2-diamine;iron(2+) (PubChem CID 161287754) has the molecular formula C36H34FeN2P2 and a molecular weight of 612.48 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl(diphenyl)phosphane;1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethane-1,2-diamine;iron(2+).
| Compound Name | cyclopenta-1,3-dien-1-yl(diphenyl)phosphane;1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethane-1,2-diamine;iron(2+) |
|---|---|
| PubChem CID | 161287754 |
| Molecular Formula | C36H34FeN2P2 |
| Molecular Weight | 612.48 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl(diphenyl)phosphane;1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethane-1,2-diamine;iron(2+) |
| SMILES | NCC(N)[c-]1cccc1P(c1ccccc1)c1ccccc1.[Fe+2].c1ccc(P(c2ccccc2)c2ccc[cH-]2)cc1 |
| InChI | InChI=1S/C19H20N2P.C17H14P.Fe/c20-14-18(21)17-12-7-13-19(17)22(15-8-3-1-4-9-15)16-10-5-2-6-11-16;1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;/h1-13,18H,14,20-21H2;1-14H;/q2*-1;+2 |
| InChIKey | VFYDQLUPXAVOIK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|