C25H33NP2 — CID 176528493
1-(3-diethylphosphanyl-2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)-N,N-dimethylethanamine (PubChem CID 176528493) has the molecular formula C25H33NP2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 1-(3-diethylphosphanyl-2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)-N,N-dimethylethanamine.
| Compound Name | 1-(3-diethylphosphanyl-2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 176528493 |
| Molecular Formula | C25H33NP2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 1-(3-diethylphosphanyl-2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)-N,N-dimethylethanamine |
| SMILES | CCP(CC)C1C=CC(C(C)N(C)C)=C1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H33NP2/c1-6-27(7-2)24-19-18-23(20(3)26(4)5)25(24)28(21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-20,24H,6-7H2,1-5H3 |
| InChIKey | KWQDHZQYQIQEBY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|