C16H29N2P — CID 70455787
1-[1-(dimethylamino)propyl-phenylphosphanyl]-N,N-dimethylpropan-1-amine (PubChem CID 70455787) has the molecular formula C16H29N2P and a molecular weight of 280.40 g/mol. Its IUPAC name is 1-[1-(dimethylamino)propyl-phenylphosphanyl]-N,N-dimethylpropan-1-amine.
| Compound Name | 1-[1-(dimethylamino)propyl-phenylphosphanyl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 70455787 |
| Molecular Formula | C16H29N2P |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | 1-[1-(dimethylamino)propyl-phenylphosphanyl]-N,N-dimethylpropan-1-amine |
| SMILES | CCC(N(C)C)P(c1ccccc1)C(CC)N(C)C |
| InChI | InChI=1S/C16H29N2P/c1-7-15(17(3)4)19(16(8-2)18(5)6)14-12-10-9-11-13-14/h9-13,15-16H,7-8H2,1-6H3 |
| InChIKey | PVBKFRKRPHYFNY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|