C20H28NOP — CID 23650610
(1S,2R)-2-[[butan-2-yl(phenyl)phosphanyl]-methylamino]-1-phenylpropan-1-ol (PubChem CID 23650610) has the molecular formula C20H28NOP and a molecular weight of 329.42 g/mol. Its IUPAC name is (1S,2R)-2-[[butan-2-yl(phenyl)phosphanyl]-methylamino]-1-phenylpropan-1-ol.
| Compound Name | (1S,2R)-2-[[butan-2-yl(phenyl)phosphanyl]-methylamino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 23650610 |
| Molecular Formula | C20H28NOP |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | (1S,2R)-2-[[butan-2-yl(phenyl)phosphanyl]-methylamino]-1-phenylpropan-1-ol |
| SMILES | CCC(C)[P@](c1ccccc1)N(C)[C@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H28NOP/c1-5-16(2)23(19-14-10-7-11-15-19)21(4)17(3)20(22)18-12-8-6-9-13-18/h6-17,20,22H,5H2,1-4H3/t16?,17-,20-,23-/m1/s1 |
| InChIKey | XGCKZVYKOPHWNO-YKSJBVHGSA-N |
| XLogP | 4.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|