C18H31P — CID 174333758
bis(3,3-dimethylbutan-2-yl)-phenylphosphane (PubChem CID 174333758) has the molecular formula C18H31P and a molecular weight of 278.42 g/mol. Its IUPAC name is bis(3,3-dimethylbutan-2-yl)-phenylphosphane.
| Compound Name | bis(3,3-dimethylbutan-2-yl)-phenylphosphane |
|---|---|
| PubChem CID | 174333758 |
| Molecular Formula | C18H31P |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | bis(3,3-dimethylbutan-2-yl)-phenylphosphane |
| SMILES | CC(P(c1ccccc1)C(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H31P/c1-14(17(3,4)5)19(15(2)18(6,7)8)16-12-10-9-11-13-16/h9-15H,1-8H3 |
| InChIKey | VGNITOOVDSUJAV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|