C27H24Cl2NiP2 — CID 87282083
(1,1-dichloro-1-diphenylphosphanylpropan-2-yl)-diphenylphosphane;nickel (PubChem CID 87282083) has the molecular formula C27H24Cl2NiP2 and a molecular weight of 540.04 g/mol. Its IUPAC name is (1,1-dichloro-1-diphenylphosphanylpropan-2-yl)-diphenylphosphane;nickel.
| Compound Name | (1,1-dichloro-1-diphenylphosphanylpropan-2-yl)-diphenylphosphane;nickel |
|---|---|
| PubChem CID | 87282083 |
| Molecular Formula | C27H24Cl2NiP2 |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 538.01 |
| IUPAC Name | (1,1-dichloro-1-diphenylphosphanylpropan-2-yl)-diphenylphosphane;nickel |
| SMILES | CC(P(c1ccccc1)c1ccccc1)C(Cl)(Cl)P(c1ccccc1)c1ccccc1.[Ni] |
| InChI | InChI=1S/C27H24Cl2P2.Ni/c1-22(30(23-14-6-2-7-15-23)24-16-8-3-9-17-24)27(28,29)31(25-18-10-4-11-19-25)26-20-12-5-13-21-26;/h2-22H,1H3; |
| InChIKey | WMQBDTKYWOKXJA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|