C14H16NO2PS — CID 174898207
1-diphenylphosphanylethanesulfonamide (PubChem CID 174898207) has the molecular formula C14H16NO2PS and a molecular weight of 293.33 g/mol. Its IUPAC name is 1-diphenylphosphanylethanesulfonamide.
| Compound Name | 1-diphenylphosphanylethanesulfonamide |
|---|---|
| PubChem CID | 174898207 |
| Molecular Formula | C14H16NO2PS |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 1-diphenylphosphanylethanesulfonamide |
| SMILES | CC(P(c1ccccc1)c1ccccc1)S(N)(=O)=O |
| InChI | InChI=1S/C14H16NO2PS/c1-12(19(15,16)17)18(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12H,1H3,(H2,15,16,17) |
| InChIKey | ZHHZAAIRUZOJAB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|