C17H20LiO4PS — CID 74085086
lithium 4-diphenylphosphanylpentan-2-yl sulfate (PubChem CID 74085086) has the molecular formula C17H20LiO4PS and a molecular weight of 358.32 g/mol. Its IUPAC name is lithium 4-diphenylphosphanylpentan-2-yl sulfate.
| Compound Name | lithium 4-diphenylphosphanylpentan-2-yl sulfate |
|---|---|
| PubChem CID | 74085086 |
| Molecular Formula | C17H20LiO4PS |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | lithium 4-diphenylphosphanylpentan-2-yl sulfate |
| SMILES | CC(CC(C)P(c1ccccc1)c1ccccc1)OS(=O)(=O)[O-].[Li+] |
| InChI | InChI=1S/C17H21O4PS.Li/c1-14(21-23(18,19)20)13-15(2)22(16-9-5-3-6-10-16)17-11-7-4-8-12-17;/h3-12,14-15H,13H2,1-2H3,(H,18,19,20);/q;+1/p-1 |
| InChIKey | YYEVKFYCQFAEHV-UHFFFAOYSA-M |
| XLogP | -0.23 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|