C35H35P2+ — CID 11016754
[(2R,4R)-4-diphenylphosphanylpentan-2-yl]-triphenylphosphanium (PubChem CID 11016754) has the molecular formula C35H35P2+ and a molecular weight of 517.61 g/mol. Its IUPAC name is [(2R,4R)-4-diphenylphosphanylpentan-2-yl]-triphenylphosphanium.
| Compound Name | [(2R,4R)-4-diphenylphosphanylpentan-2-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 11016754 |
| Molecular Formula | C35H35P2+ |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | [(2R,4R)-4-diphenylphosphanylpentan-2-yl]-triphenylphosphanium |
| SMILES | C[C@H](C[C@@H](C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H35P2/c1-29(36(31-18-8-3-9-19-31)32-20-10-4-11-21-32)28-30(2)37(33-22-12-5-13-23-33,34-24-14-6-15-25-34)35-26-16-7-17-27-35/h3-27,29-30H,28H2,1-2H3/q+1/t29-,30-/m1/s1 |
| InChIKey | QAFFMWMCRSIEIV-LOYHVIPDSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|