About 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel
1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel (PubChem CID 87791528) has the molecular formula C27H25NiP2-
and a molecular weight of 470.14 g/mol. Its IUPAC name is 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel.
Molecular Properties
| Compound Name | 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel |
| PubChem CID | 87791528 |
| Molecular Formula | C27H25NiP2- |
| Molecular Weight | 470.14 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel |
| SMILES | CC([CH-]P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1.[Ni] |
| InChI | InChI=1S/C27H25P2.Ni/c1-23(29(26-18-10-4-11-19-26)27-20-12-5-13-21-27)22-28(24-14-6-2-7-15-24)25-16-8-3-9-17-25;/h2-23H,1H3;/q-1; |
| InChIKey | PHHQGRRILNJQFF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.14 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel?
The IUPAC name of 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel (CID 87791528) is 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel.
What is the SMILES notation for 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel?
The canonical SMILES for 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel is CC([CH-]P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1.[Ni].
What is the InChIKey of 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel?
The InChIKey is PHHQGRRILNJQFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25P2.Ni/c1-23(29(26-18-10-4-11-19-26)27-20-12-5-13-21-27)22-28(24-14-6-2-7-15-24)25-16-8-3-9-17-25;/h2-23H,1H3;/q-1;.
What are the key properties of 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel?
1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel has a molecular weight of 470.14 g/mol, XLogP of 5.80, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane;nickel is sourced from PubChem (CID 87791528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).