C14H15O2P — CID 151023834
1-diphenylphosphanylethane-1,1-diol (PubChem CID 151023834) has the molecular formula C14H15O2P and a molecular weight of 246.25 g/mol. Its IUPAC name is 1-diphenylphosphanylethane-1,1-diol.
| Compound Name | 1-diphenylphosphanylethane-1,1-diol |
|---|---|
| PubChem CID | 151023834 |
| Molecular Formula | C14H15O2P |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-diphenylphosphanylethane-1,1-diol |
| SMILES | CC(O)(O)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H15O2P/c1-14(15,16)17(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,15-16H,1H3 |
| InChIKey | LYQCICLFYRSFCU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|