C18H24NP — CID 10731871
(2S)-1-diphenylphosphanyl-3,3-dimethylbutan-2-amine (PubChem CID 10731871) has the molecular formula C18H24NP and a molecular weight of 285.37 g/mol. Its IUPAC name is (2S)-1-diphenylphosphanyl-3,3-dimethylbutan-2-amine.
| Compound Name | (2S)-1-diphenylphosphanyl-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 10731871 |
| Molecular Formula | C18H24NP |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (2S)-1-diphenylphosphanyl-3,3-dimethylbutan-2-amine |
| SMILES | CC(C)(C)[C@H](N)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24NP/c1-18(2,3)17(19)14-20(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17H,14,19H2,1-3H3/t17-/m1/s1 |
| InChIKey | SGBNMEAXYLJQRV-QGZVFWFLSA-N |
| XLogP | 3.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|