C18H23OPRh — CID 88689211
2,2-dimethylpropyl(diphenyl)phosphane;formaldehyde;rhodium (PubChem CID 88689211) has the molecular formula C18H23OPRh and a molecular weight of 389.26 g/mol. Its IUPAC name is 2,2-dimethylpropyl(diphenyl)phosphane;formaldehyde;rhodium.
| Compound Name | 2,2-dimethylpropyl(diphenyl)phosphane;formaldehyde;rhodium |
|---|---|
| PubChem CID | 88689211 |
| Molecular Formula | C18H23OPRh |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 2,2-dimethylpropyl(diphenyl)phosphane;formaldehyde;rhodium |
| SMILES | C=O.CC(C)(C)CP(c1ccccc1)c1ccccc1.[Rh] |
| InChI | InChI=1S/C17H21P.CH2O.Rh/c1-17(2,3)14-18(15-10-6-4-7-11-15)16-12-8-5-9-13-16;1-2;/h4-13H,14H2,1-3H3;1H2; |
| InChIKey | IQWOAKFAJRPRGM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|