C26H24P2S2 — CID 88810681
1,2-bis(diphenylphosphanyl)ethane-1,1-dithiol (PubChem CID 88810681) has the molecular formula C26H24P2S2 and a molecular weight of 462.56 g/mol. Its IUPAC name is 1,2-bis(diphenylphosphanyl)ethane-1,1-dithiol.
| Compound Name | 1,2-bis(diphenylphosphanyl)ethane-1,1-dithiol |
|---|---|
| PubChem CID | 88810681 |
| Molecular Formula | C26H24P2S2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 1,2-bis(diphenylphosphanyl)ethane-1,1-dithiol |
| SMILES | SC(S)(CP(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24P2S2/c29-26(30,28(24-17-9-3-10-18-24)25-19-11-4-12-20-25)21-27(22-13-5-1-6-14-22)23-15-7-2-8-16-23/h1-20,29-30H,21H2 |
| InChIKey | NAAQXUVSYZRLHY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|