C27H24Cl2NiP2+2 — CID 131716311
(2,2-dichloro-3-diphenylphosphanylpropyl)-diphenylphosphane;nickel(2+) (PubChem CID 131716311) has the molecular formula C27H24Cl2NiP2+2 and a molecular weight of 540.04 g/mol. Its IUPAC name is (2,2-dichloro-3-diphenylphosphanylpropyl)-diphenylphosphane;nickel(2+).
| Compound Name | (2,2-dichloro-3-diphenylphosphanylpropyl)-diphenylphosphane;nickel(2+) |
|---|---|
| PubChem CID | 131716311 |
| Molecular Formula | C27H24Cl2NiP2+2 |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 538.01 |
| IUPAC Name | (2,2-dichloro-3-diphenylphosphanylpropyl)-diphenylphosphane;nickel(2+) |
| SMILES | ClC(Cl)(CP(c1ccccc1)c1ccccc1)CP(c1ccccc1)c1ccccc1.[Ni+2] |
| InChI | InChI=1S/C27H24Cl2P2.Ni/c28-27(29,21-30(23-13-5-1-6-14-23)24-15-7-2-8-16-24)22-31(25-17-9-3-10-18-25)26-19-11-4-12-20-26;/h1-20H,21-22H2;/q;+2 |
| InChIKey | GIFASXCPIBNWQA-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|