C26H22Br2P2 — CID 21297174
(1,1-dibromo-2-diphenylphosphanylethyl)-diphenylphosphane (PubChem CID 21297174) has the molecular formula C26H22Br2P2 and a molecular weight of 556.22 g/mol. Its IUPAC name is (1,1-dibromo-2-diphenylphosphanylethyl)-diphenylphosphane.
| Compound Name | (1,1-dibromo-2-diphenylphosphanylethyl)-diphenylphosphane |
|---|---|
| PubChem CID | 21297174 |
| Molecular Formula | C26H22Br2P2 |
| Molecular Weight | 556.22 g/mol |
| Exact Mass | 553.96 |
| IUPAC Name | (1,1-dibromo-2-diphenylphosphanylethyl)-diphenylphosphane |
| SMILES | BrC(Br)(CP(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H22Br2P2/c27-26(28,30(24-17-9-3-10-18-24)25-19-11-4-12-20-25)21-29(22-13-5-1-6-14-22)23-15-7-2-8-16-23/h1-20H,21H2 |
| InChIKey | QFZAVFSEPORIKI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.22 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|