C20H27N2P — CID 23420494
N'-(1-diphenylphosphanyl-3-methylbutan-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 23420494) has the molecular formula C20H27N2P and a molecular weight of 326.42 g/mol. Its IUPAC name is N'-(1-diphenylphosphanyl-3-methylbutan-2-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(1-diphenylphosphanyl-3-methylbutan-2-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 23420494 |
| Molecular Formula | C20H27N2P |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | N'-(1-diphenylphosphanyl-3-methylbutan-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CC(C)C(CP(c1ccccc1)c1ccccc1)/N=C/N(C)C |
| InChI | InChI=1S/C20H27N2P/c1-17(2)20(21-16-22(3)4)15-23(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,16-17,20H,15H2,1-4H3/b21-16+ |
| InChIKey | RJRGZKSNUYPJSR-LTGZKZEYSA-N |
| XLogP | 3.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|