C26H31N2P — CID 11047705
(2S)-1-diphenylphosphanyl-3-methyl-N-[(E)-2-phenylpropylideneamino]butan-2-amine (PubChem CID 11047705) has the molecular formula C26H31N2P and a molecular weight of 402.52 g/mol. Its IUPAC name is (2S)-1-diphenylphosphanyl-3-methyl-N-[(E)-2-phenylpropylideneamino]butan-2-amine.
| Compound Name | (2S)-1-diphenylphosphanyl-3-methyl-N-[(E)-2-phenylpropylideneamino]butan-2-amine |
|---|---|
| PubChem CID | 11047705 |
| Molecular Formula | C26H31N2P |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (2S)-1-diphenylphosphanyl-3-methyl-N-[(E)-2-phenylpropylideneamino]butan-2-amine |
| SMILES | CC(/C=N/N[C@H](CP(c1ccccc1)c1ccccc1)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H31N2P/c1-21(2)26(28-27-19-22(3)23-13-7-4-8-14-23)20-29(24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-19,21-22,26,28H,20H2,1-3H3/b27-19+/t22?,26-/m1/s1 |
| InChIKey | NUHIBMJARFCWCQ-YPNQGOOPSA-N |
| XLogP | 5.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|