C38H46N2O2P2 — CID 11814191
N,N'-bis[(2S)-1-diphenylphosphanyl-3-methylbutan-2-yl]butanediamide (PubChem CID 11814191) has the molecular formula C38H46N2O2P2 and a molecular weight of 624.75 g/mol. Its IUPAC name is N,N'-bis[(2S)-1-diphenylphosphanyl-3-methylbutan-2-yl]butanediamide.
| Compound Name | N,N'-bis[(2S)-1-diphenylphosphanyl-3-methylbutan-2-yl]butanediamide |
|---|---|
| PubChem CID | 11814191 |
| Molecular Formula | C38H46N2O2P2 |
| Molecular Weight | 624.75 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | N,N'-bis[(2S)-1-diphenylphosphanyl-3-methylbutan-2-yl]butanediamide |
| SMILES | CC(C)[C@@H](CP(c1ccccc1)c1ccccc1)NC(=O)CCC(=O)N[C@H](CP(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C38H46N2O2P2/c1-29(2)35(27-43(31-17-9-5-10-18-31)32-19-11-6-12-20-32)39-37(41)25-26-38(42)40-36(30(3)4)28-44(33-21-13-7-14-22-33)34-23-15-8-16-24-34/h5-24,29-30,35-36H,25-28H2,1-4H3,(H,39,41)(H,40,42)/t35-,36-/m1/s1 |
| InChIKey | OHJKNUZTCYFEPI-LQFQNGICSA-N |
| XLogP | 6.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.75 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|