C28H41N2O3P — CID 164673101
tert-butyl N-[1-[[(2S)-1-diphenylphosphanyl-3,3-dimethylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 164673101) has the molecular formula C28H41N2O3P and a molecular weight of 484.62 g/mol. Its IUPAC name is tert-butyl N-[1-[[(2S)-1-diphenylphosphanyl-3,3-dimethylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[(2S)-1-diphenylphosphanyl-3,3-dimethylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 164673101 |
| Molecular Formula | C28H41N2O3P |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | tert-butyl N-[1-[[(2S)-1-diphenylphosphanyl-3,3-dimethylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)N[C@H](CP(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H41N2O3P/c1-20(2)24(30-26(32)33-28(6,7)8)25(31)29-23(27(3,4)5)19-34(21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,20,23-24H,19H2,1-8H3,(H,29,31)(H,30,32)/t23-,24?/m1/s1 |
| InChIKey | OCIHOSQPUIBIRI-MIHMCVIASA-N |
| XLogP | 5.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|