C27H39N2O3P — CID 164672848
tert-butyl N-[1-[[(2S)-1-diphenylphosphanyl-3-methylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 164672848) has the molecular formula C27H39N2O3P and a molecular weight of 470.59 g/mol. Its IUPAC name is tert-butyl N-[1-[[(2S)-1-diphenylphosphanyl-3-methylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[(2S)-1-diphenylphosphanyl-3-methylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 164672848 |
| Molecular Formula | C27H39N2O3P |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | tert-butyl N-[1-[[(2S)-1-diphenylphosphanyl-3-methylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)N[C@H](CP(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C27H39N2O3P/c1-19(2)23(28-25(30)24(20(3)4)29-26(31)32-27(5,6)7)18-33(21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17,19-20,23-24H,18H2,1-7H3,(H,28,30)(H,29,31)/t23-,24?/m1/s1 |
| InChIKey | UNRBPZSUAVRFRB-MIHMCVIASA-N |
| XLogP | 4.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|