C10H12N6 — CID 26975194
N-[(Z)-[(2R)-2-phenylpropylidene]amino]-2H-tetrazol-5-amine (PubChem CID 26975194) has the molecular formula C10H12N6 and a molecular weight of 216.25 g/mol. Its IUPAC name is N-[(Z)-[(2R)-2-phenylpropylidene]amino]-2H-tetrazol-5-amine.
| Compound Name | N-[(Z)-[(2R)-2-phenylpropylidene]amino]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 26975194 |
| Molecular Formula | C10H12N6 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | N-[(Z)-[(2R)-2-phenylpropylidene]amino]-2H-tetrazol-5-amine |
| SMILES | C[C@@H](/C=N\Nc1nn[nH]n1)c1ccccc1 |
| InChI | InChI=1S/C10H12N6/c1-8(9-5-3-2-4-6-9)7-11-12-10-13-15-16-14-10/h2-8H,1H3,(H2,12,13,14,15,16)/b11-7-/t8-/m0/s1 |
| InChIKey | WHDGXYMSPXPCPZ-CLUBXZQOSA-N |
| XLogP | 1.40 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|