C12H9N6O- — CID 7065258
1-[(Z)-(2H-tetrazol-5-ylhydrazinylidene)methyl]naphthalen-2-olate (PubChem CID 7065258) has the molecular formula C12H9N6O- and a molecular weight of 253.25 g/mol. Its IUPAC name is 1-[(Z)-(2H-tetrazol-5-ylhydrazinylidene)methyl]naphthalen-2-olate.
| Compound Name | 1-[(Z)-(2H-tetrazol-5-ylhydrazinylidene)methyl]naphthalen-2-olate |
|---|---|
| PubChem CID | 7065258 |
| Molecular Formula | C12H9N6O- |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 1-[(Z)-(2H-tetrazol-5-ylhydrazinylidene)methyl]naphthalen-2-olate |
| SMILES | [O-]c1ccc2ccccc2c1/C=N\Nc1nn[nH]n1 |
| InChI | InChI=1S/C12H10N6O/c19-11-6-5-8-3-1-2-4-9(8)10(11)7-13-14-12-15-17-18-16-12/h1-7,19H,(H2,14,15,16,17,18)/p-1/b13-7- |
| InChIKey | SIDSDJZHUIIWQR-QPEQYQDCSA-M |
| XLogP | 0.87 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|