C12H9N5O — CID 136695197
1-(2H-tetrazol-5-yliminomethyl)naphthalen-2-ol (PubChem CID 136695197) has the molecular formula C12H9N5O and a molecular weight of 239.24 g/mol. Its IUPAC name is 1-(2H-tetrazol-5-yliminomethyl)naphthalen-2-ol.
| Compound Name | 1-(2H-tetrazol-5-yliminomethyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 136695197 |
| Molecular Formula | C12H9N5O |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 1-(2H-tetrazol-5-yliminomethyl)naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1C=Nc1nn[nH]n1 |
| InChI | InChI=1S/C12H9N5O/c18-11-6-5-8-3-1-2-4-9(8)10(11)7-13-12-14-16-17-15-12/h1-7,18H,(H,14,15,16,17) |
| InChIKey | SMOYHYICXQQWRR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|