C24H24N4O3 — CID 40571735
2-N,5-N-bis[(Z)-[(2S)-2-phenylpropylidene]amino]furan-2,5-dicarboxamide (PubChem CID 40571735) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-N,5-N-bis[(Z)-[(2S)-2-phenylpropylidene]amino]furan-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[(Z)-[(2S)-2-phenylpropylidene]amino]furan-2,5-dicarboxamide |
|---|---|
| PubChem CID | 40571735 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-N,5-N-bis[(Z)-[(2S)-2-phenylpropylidene]amino]furan-2,5-dicarboxamide |
| SMILES | C[C@H](/C=N\NC(=O)c1ccc(C(=O)N/N=C\[C@@H](C)c2ccccc2)o1)c1ccccc1 |
| InChI | InChI=1S/C24H24N4O3/c1-17(19-9-5-3-6-10-19)15-25-27-23(29)21-13-14-22(31-21)24(30)28-26-16-18(2)20-11-7-4-8-12-20/h3-18H,1-2H3,(H,27,29)(H,28,30)/b25-15-,26-16-/t17-,18-/m1/s1 |
| InChIKey | GUUZRXBELDZGCJ-CQLZRFFISA-N |
| XLogP | 4.32 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|