C14H20N4O3 — CID 4614980
2-N,5-N-bis(2-methylpropylideneamino)furan-2,5-dicarboxamide (PubChem CID 4614980) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-N,5-N-bis(2-methylpropylideneamino)furan-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(2-methylpropylideneamino)furan-2,5-dicarboxamide |
|---|---|
| PubChem CID | 4614980 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-N,5-N-bis(2-methylpropylideneamino)furan-2,5-dicarboxamide |
| SMILES | CC(C)C=NNC(=O)c1ccc(C(=O)NN=CC(C)C)o1 |
| InChI | InChI=1S/C14H20N4O3/c1-9(2)7-15-17-13(19)11-5-6-12(21-11)14(20)18-16-8-10(3)4/h5-10H,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | JZYFHFZTHQSVCW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|