C25H32NOPSi — CID 87635133
5-[1-(dimethylamino)ethyl]-4-diphenylphosphanyl-2-trimethylsilylcyclopenta-1,3-diene-1-carbaldehyde (PubChem CID 87635133) has the molecular formula C25H32NOPSi and a molecular weight of 421.60 g/mol. Its IUPAC name is 5-[1-(dimethylamino)ethyl]-4-diphenylphosphanyl-2-trimethylsilylcyclopenta-1,3-diene-1-carbaldehyde.
| Compound Name | 5-[1-(dimethylamino)ethyl]-4-diphenylphosphanyl-2-trimethylsilylcyclopenta-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 87635133 |
| Molecular Formula | C25H32NOPSi |
| Molecular Weight | 421.60 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 5-[1-(dimethylamino)ethyl]-4-diphenylphosphanyl-2-trimethylsilylcyclopenta-1,3-diene-1-carbaldehyde |
| SMILES | CC(C1C(P(c2ccccc2)c2ccccc2)=CC([Si](C)(C)C)=C1C=O)N(C)C |
| InChI | InChI=1S/C25H32NOPSi/c1-19(26(2)3)25-22(18-27)24(29(4,5)6)17-23(25)28(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-19,25H,1-6H3 |
| InChIKey | ALTDYFGKQKBPBN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|