C23H32NP — CID 59690756
(1S)-1-(2-diphenylphosphanyl-3-methylcyclohexyl)-N,N-dimethylethanamine (PubChem CID 59690756) has the molecular formula C23H32NP and a molecular weight of 353.49 g/mol. Its IUPAC name is (1S)-1-(2-diphenylphosphanyl-3-methylcyclohexyl)-N,N-dimethylethanamine.
| Compound Name | (1S)-1-(2-diphenylphosphanyl-3-methylcyclohexyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 59690756 |
| Molecular Formula | C23H32NP |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | (1S)-1-(2-diphenylphosphanyl-3-methylcyclohexyl)-N,N-dimethylethanamine |
| SMILES | CC1CCCC([C@H](C)N(C)C)C1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H32NP/c1-18-12-11-17-22(19(2)24(3)4)23(18)25(20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-10,13-16,18-19,22-23H,11-12,17H2,1-4H3/t18?,19-,22?,23?/m0/s1 |
| InChIKey | COUOENAXMOWZNH-BVQNBUCBSA-N |
| XLogP | 4.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|