C17H27NP+ — CID 58921842
CID 58921842 (PubChem CID 58921842) has the molecular formula C17H27NP+ and a molecular weight of 276.38 g/mol.
| Compound Name | CID 58921842 |
|---|---|
| PubChem CID | 58921842 |
| Molecular Formula | C17H27NP+ |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | — |
| SMILES | [CH][P+](C)(c1ccccc1)C1CCCC1[C@@H](C)N(C)C |
| InChI | InChI=1S/C17H27NP/c1-14(18(2)3)16-12-9-13-17(16)19(4,5)15-10-7-6-8-11-15/h4,6-8,10-11,14,16-17H,9,12-13H2,1-3,5H3/q+1/t14-,16?,17?,19?/m1/s1 |
| InChIKey | UPKNCJCSQRXCLH-AEGNVBMISA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|