C15H23ClNP — CID 58470969
(1R)-1-[2-[chloro(phenyl)phosphanyl]cyclopentyl]-N,N-dimethylethanamine (PubChem CID 58470969) has the molecular formula C15H23ClNP and a molecular weight of 283.78 g/mol. Its IUPAC name is (1R)-1-[2-[chloro(phenyl)phosphanyl]cyclopentyl]-N,N-dimethylethanamine.
| Compound Name | (1R)-1-[2-[chloro(phenyl)phosphanyl]cyclopentyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 58470969 |
| Molecular Formula | C15H23ClNP |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (1R)-1-[2-[chloro(phenyl)phosphanyl]cyclopentyl]-N,N-dimethylethanamine |
| SMILES | C[C@H](C1CCCC1P(Cl)c1ccccc1)N(C)C |
| InChI | InChI=1S/C15H23ClNP/c1-12(17(2)3)14-10-7-11-15(14)18(16)13-8-5-4-6-9-13/h4-6,8-9,12,14-15H,7,10-11H2,1-3H3/t12-,14?,15?,18?/m1/s1 |
| InChIKey | UYCLUUHVODYIEK-WCZUTWHYSA-N |
| XLogP | 4.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|