C22H39NP+ — CID 90743045
cyclopentane;[2-[(1R)-1-(dimethylamino)ethyl]cyclopentyl]-dimethyl-phenylphosphanium (PubChem CID 90743045) has the molecular formula C22H39NP+ and a molecular weight of 348.54 g/mol. Its IUPAC name is cyclopentane;[2-[(1R)-1-(dimethylamino)ethyl]cyclopentyl]-dimethyl-phenylphosphanium.
| Compound Name | cyclopentane;[2-[(1R)-1-(dimethylamino)ethyl]cyclopentyl]-dimethyl-phenylphosphanium |
|---|---|
| PubChem CID | 90743045 |
| Molecular Formula | C22H39NP+ |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | cyclopentane;[2-[(1R)-1-(dimethylamino)ethyl]cyclopentyl]-dimethyl-phenylphosphanium |
| SMILES | C1CCCC1.C[C@H](C1CCCC1[P+](C)(C)c1ccccc1)N(C)C |
| InChI | InChI=1S/C17H29NP.C5H10/c1-14(18(2)3)16-12-9-13-17(16)19(4,5)15-10-7-6-8-11-15;1-2-4-5-3-1/h6-8,10-11,14,16-17H,9,12-13H2,1-5H3;1-5H2/q+1;/t14-,16?,17?;/m1./s1 |
| InChIKey | GWDUETCCTNFKAH-WSAUOBDVSA-N |
| XLogP | 5.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|