C14H22OP+ — CID 90741599
[2-(hydroxymethyl)cyclopentyl]-dimethyl-phenylphosphanium (PubChem CID 90741599) has the molecular formula C14H22OP+ and a molecular weight of 237.30 g/mol. Its IUPAC name is [2-(hydroxymethyl)cyclopentyl]-dimethyl-phenylphosphanium.
| Compound Name | [2-(hydroxymethyl)cyclopentyl]-dimethyl-phenylphosphanium |
|---|---|
| PubChem CID | 90741599 |
| Molecular Formula | C14H22OP+ |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | [2-(hydroxymethyl)cyclopentyl]-dimethyl-phenylphosphanium |
| SMILES | C[P+](C)(c1ccccc1)C1CCCC1CO |
| InChI | InChI=1S/C14H22OP/c1-16(2,13-8-4-3-5-9-13)14-10-6-7-12(14)11-15/h3-5,8-9,12,14-15H,6-7,10-11H2,1-2H3/q+1 |
| InChIKey | CRSTUCQXASJEMJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|