C19H30O3P+ — CID 91349043
[2-[(2S,4S)-4-(methoxymethyl)-1,3-dioxan-2-yl]cyclopentyl]-dimethyl-phenylphosphanium (PubChem CID 91349043) has the molecular formula C19H30O3P+ and a molecular weight of 337.42 g/mol. Its IUPAC name is [2-[(2S,4S)-4-(methoxymethyl)-1,3-dioxan-2-yl]cyclopentyl]-dimethyl-phenylphosphanium.
| Compound Name | [2-[(2S,4S)-4-(methoxymethyl)-1,3-dioxan-2-yl]cyclopentyl]-dimethyl-phenylphosphanium |
|---|---|
| PubChem CID | 91349043 |
| Molecular Formula | C19H30O3P+ |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [2-[(2S,4S)-4-(methoxymethyl)-1,3-dioxan-2-yl]cyclopentyl]-dimethyl-phenylphosphanium |
| SMILES | COC[C@@H]1CCO[C@H](C2CCCC2[P+](C)(C)c2ccccc2)O1 |
| InChI | InChI=1S/C19H30O3P/c1-20-14-15-12-13-21-19(22-15)17-10-7-11-18(17)23(2,3)16-8-5-4-6-9-16/h4-6,8-9,15,17-19H,7,10-14H2,1-3H3/q+1/t15-,17?,18?,19-/m0/s1 |
| InChIKey | MQNJXMMESLXJSX-RXQRSOPUSA-N |
| XLogP | 3.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|