C18H29BN2O2P+ — CID 58903834
CID 58903834 (PubChem CID 58903834) has the molecular formula C18H29BN2O2P+ and a molecular weight of 347.23 g/mol.
| Compound Name | CID 58903834 |
|---|---|
| PubChem CID | 58903834 |
| Molecular Formula | C18H29BN2O2P+ |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | — |
| SMILES | [B][P+](c1ccccc1)(N1CCC[C@H]1COC)N1CCC[C@H]1COC |
| InChI | InChI=1S/C18H29BN2O2P/c1-22-14-16-8-6-12-20(16)24(19,18-10-4-3-5-11-18)21-13-7-9-17(21)15-23-2/h3-5,10-11,16-17H,6-9,12-15H2,1-2H3/q+1/t16-,17-/m0/s1 |
| InChIKey | IKUCPHYYRWMEQR-IRXDYDNUSA-N |
| XLogP | 2.46 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|