C18H22N2O — CID 177467304
(E)-1-cyclopenta-2,4-dien-1-yl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylmethanimine (PubChem CID 177467304) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is (E)-1-cyclopenta-2,4-dien-1-yl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylmethanimine.
| Compound Name | (E)-1-cyclopenta-2,4-dien-1-yl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 177467304 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (E)-1-cyclopenta-2,4-dien-1-yl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylmethanimine |
| SMILES | COC[C@@H]1CCCN1/N=C(/c1ccccc1)C1C=CC=C1 |
| InChI | InChI=1S/C18H22N2O/c1-21-14-17-12-7-13-20(17)19-18(16-10-5-6-11-16)15-8-3-2-4-9-15/h2-6,8-11,16-17H,7,12-14H2,1H3/b19-18-/t17-/m0/s1 |
| InChIKey | OAIWDQGAGWCICI-NSURYPBFSA-N |
| XLogP | 3.24 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|